| Product Name | 6-bromo-8-methoxy-2-oxo-2H-chromene-3-carboxylic acid |
| CAS No. | 119686-34-9 |
| InChI | InChI=1/C11H7BrO5/c1-16-8-4-6(12)2-5-3-7(10(13)14)11(15)17-9(5)8/h2-4H,1H3,(H,13,14) |
| Molecular Formula | C11H7BrO5 |
| Molecular Weight | 299.0743 |
| Density | 1.785g/cm3 |
| Melting point | 225℃ |
| Boiling point | 477.1°C at 760 mmHg |
| Flash point | 242.3°C |
| Refractive index | 1.638 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
119686-34-9 6-bromo-8-methoxy-2-oxo-2h-chromene-3-carboxylic acid
service@apichina.com