| Product Name | 6-bromo-2-naphthoic acid |
| CAS No. | 5773-80-8 |
| Synonyms | 2-naphthalenecarboxylic acid, 6-bromo-; 6-Bromo-2-naphthoicacid; 6-bromonaphthalene-2-carboxylic acid; 6-Bromo-2-naphthoicacid,96%; 6-BROMO-2-NAPHTHOIC ACID 99%; 6-bromo-2-Naphthalenecarboxylic acid |
| InChI | InChI=1/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| Molecular Formula | C11H7BrO2 |
| Molecular Weight | 251.0761 |
| Density | 1.648g/cm3 |
| Melting point | 294-295℃ |
| Boiling point | 387.3°C at 760 mmHg |
| Flash point | 188°C |
| Refractive index | 1.697 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5773-80-8 6-bromo-2-naphthoic acid
service@apichina.com