| Product Name | 6-bromo-1-(chloromethyl)-2-methoxynaphthalene |
| CAS No. | 92643-16-8 |
| Synonyms | w6-Bromo-1-(chloromethyl)-2-methoxynaphthalene |
| InChI | InChI=1/C12H10BrClO/c1-15-12-5-2-8-6-9(13)3-4-10(8)11(12)7-14/h2-6H,7H2,1H3 |
| Molecular Formula | C12H10BrClO |
| Molecular Weight | 285.5642 |
| Density | 1.491g/cm3 |
| Melting point | 144℃ |
| Boiling point | 379.5°C at 760 mmHg |
| Flash point | 183.3°C |
| Refractive index | 1.631 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
92643-16-8 6-bromo-1-(chloromethyl)-2-methoxynaphthalene
service@apichina.com