| Product Name | 6-bromo-1,3-benzothiazole |
| CAS No. | 53218-26-1 |
| Synonyms | 6-Bromobenzothiazole; 6-bromobenzo[d]thiazole |
| InChI | InChI=1/C7H4BrNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H |
| Molecular Formula | C7H4BrNS |
| Molecular Weight | 214.0824 |
| Density | 1.748g/cm3 |
| Melting point | 52℃ |
| Boiling point | 291.493°C at 760 mmHg |
| Flash point | 130.09°C |
| Refractive index | 1.718 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
53218-26-1 6-bromo-1,3-benzothiazole
service@apichina.com