| Product Name | 6-Benzoylhexanoic acid |
| CAS No. | 7472-43-7 |
| Synonyms | 7-Oxo-7-phenylheptanoic acid; 7-Oxo-7-phenyl-heptanoic acid; 6-Benzoyl hexanoic Acid |
| InChI | InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.2643 |
| Density | 1.111g/cm3 |
| Boiling point | 396°C at 760 mmHg |
| Flash point | 207.4°C |
| Refractive index | 1.528 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7472-43-7 6-benzoylhexanoic acid
service@apichina.com