| Product Name | 6-Benzoyl-2-naphthol |
| CAS No. | 52222-87-4 |
| Synonyms | 6-hydroxy-2-naphthyl phenyl ketone; (6-hydroxynaphthalen-2-yl)(phenyl)methanone |
| InChI | InChI=1/C17H12O2/c18-16-9-8-13-10-15(7-6-14(13)11-16)17(19)12-4-2-1-3-5-12/h1-11,18H |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.276 |
| Density | 1.24g/cm3 |
| Melting point | 161-162℃ |
| Boiling point | 453.8°C at 760 mmHg |
| Flash point | 193.3°C |
| Refractive index | 1.681 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
52222-87-4 6-benzoyl-2-naphthol
service@apichina.com