| Product Name | 6-Aminothymol hydrochloride |
| CAS No. | 6321-11-5 |
| Synonyms | 4-Amino-2-isopropyl-5-methylphenol hydrochloride; 4-amino-5-methyl-2-(propan-2-yl)phenol hydrochloride (1:1) |
| InChI | InChI=1/C10H15NO.ClH/c1-6(2)8-5-9(11)7(3)4-10(8)12;/h4-6,12H,11H2,1-3H3;1H |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.6931 |
| Boiling point | 304.6°C at 760 mmHg |
| Flash point | 138°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6321-11-5 6-aminothymol hydrochloride
service@apichina.com