| Product Name | 6-(Aminomethyl)indole |
| CAS No. | 3468-17-5 |
| Synonyms | INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
| InChI | InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.1891 |
| Density | 1.2g/cm3 |
| Boiling point | 335.599°C at 760 mmHg |
| Flash point | 183.277°C |
| Refractive index | 1.698 |
| Hazard Symbols |  Xi:; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3468-17-5 6-(aminomethyl)indole
service@apichina.com