| Sales Email | Service@apichina.com |
| CAS No. | 2642-98-0 |
| Product Name | 6-Aminochrysene |
| Synonyms | 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| InChI | InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.3025 |
| Density | 1.253g/cm3 |
| Melting point | 206-211℃ |
| Boiling point | 501.2°C at 760 mmHg |
| Flash point | 286.9°C |
| Refractive index | 1.813 |
| Hazard Symbols |  Xn:Harmful; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
