| Product Name | 6-amino-5-bromo-2-(ethylthio)pyrimidin-4-ol |
| CAS No. | 77708-90-8 |
| Synonyms | 6-amino-5-bromo-2-(ethylsulfanyl)pyrimidin-4(1H)-one |
| InChI | InChI=1/C6H8BrN3OS/c1-2-12-6-9-4(8)3(7)5(11)10-6/h2H2,1H3,(H3,8,9,10,11) |
| Molecular Formula | C6H8BrN3OS |
| Molecular Weight | 250.1162 |
| Density | 1.91g/cm3 |
| Melting point | 300℃ |
| Boiling point | 295.8°C at 760 mmHg |
| Flash point | 132.7°C |
| Refractive index | 1.724 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
77708-90-8 6-amino-5-bromo-2-(ethylthio)pyrimidin-4-ol
service@apichina.com