| Product Name | 6-amino-3-ethyl-4-phenyl-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| CAS No. | 444790-63-0 |
| Synonyms | 6-amino-3-ethyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| InChI | InChI=1/C15H14N4O/c1-2-11-13-12(9-6-4-3-5-7-9)10(8-16)14(17)20-15(13)19-18-11/h3-7,12H,2,17H2,1H3,(H,18,19) |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.2979 |
| Density | 1.33g/cm3 |
| Melting point | 192℃ |
| Boiling point | 530.8°C at 760 mmHg |
| Flash point | 274.8°C |
| Refractive index | 1.663 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
444790-63-0 6-amino-3-ethyl-4-phenyl-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
service@apichina.com