| Product Name | 6-Amino-2-naphthoic acid |
| CAS No. | 116668-47-4 |
| InChI | InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1 |
| Molecular Formula | C11H8NO2 |
| Molecular Weight | 186.1873 |
| Melting point | 222-227℃ |
| Boiling point | 416.7°C at 760 mmHg |
| Flash point | 205.8°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
116668-47-4 6-amino-2-naphthoic acid
service@apichina.com