| Product Name | 6-amino-1,3-dihydroisobenzofuran-1-one |
| CAS No. | 57319-65-0 |
| Synonyms | 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
| InChI | InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.1467 |
| Density | 1.376g/cm3 |
| Melting point | 182℃ |
| Boiling point | 420.2°C at 760 mmHg |
| Flash point | 248.3°C |
| Refractive index | 1.655 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
service@apichina.com