| Product Name | 6-Acetoxy-2-naphthoic acid |
| CAS No. | 17295-26-0 |
| Synonyms | 6-Acetoxy-2-naphtoic acid; 6-(acetyloxy)naphthalene-2-carboxylic acid |
| InChI | InChI=1/C13H10O4/c1-8(14)17-12-5-4-9-6-11(13(15)16)3-2-10(9)7-12/h2-7H,1H3,(H,15,16) |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.2161 |
| Density | 1.325g/cm3 |
| Boiling point | 407.5°C at 760 mmHg |
| Flash point | 159.7°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17295-26-0 6-acetoxy-2-naphthoic acid
service@apichina.com