| Sales Email | Service@apichina.com |
| CAS No. | 3855-87-6 |
| Product Name | 6,8-Dibromocoumarin-3-carboxylic acid |
| Synonyms | 6,8-Dibromo-2-oxo-2H-chromene-3-carboxylic acid; 2,5-difluoro-4-nitrobenzoate; 6,8-dibromo-2-oxo-2H-chromene-3-carboxylate |
| InChI | InChI=1/C10H4Br2O4/c11-5-1-4-2-6(9(13)14)10(15)16-8(4)7(12)3-5/h1-3H,(H,13,14)/p-1 |
| Molecular Formula | C10H3Br2O4 |
| Molecular Weight | 346.937 |
| Melting point | 221℃ |
| Boiling point | 483.2°C at 760 mmHg |
| Flash point | 246°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
