| Product Name | 6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one oxime |
| CAS No. | 175202-71-8 |
| Synonyms | 6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-one oxime; (4Z)-6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-one oxime |
| InChI | InChI=1/C11H15NOS2/c1-11(2)4-7-6-15-10(14-3)9(7)8(5-11)12-13/h6,13H,4-5H2,1-3H3/b12-8- |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.3729 |
| Density | 1.29g/cm3 |
| Melting point | 151℃ |
| Boiling point | 380.7°C at 760 mmHg |
| Flash point | 184.1°C |
| Refractive index | 1.645 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175202-71-8 6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one oxime
service@apichina.com