| Product Name | 6-(4-bromophenoxy)pyridin-3-amine |
| CAS No. | 77006-26-9 |
| InChI | InChI=1/C11H9BrN2O/c12-8-1-4-10(5-2-8)15-11-6-3-9(13)7-14-11/h1-7H,13H2 |
| Molecular Formula | C11H9BrN2O |
| Molecular Weight | 265.106 |
| Density | 1.543g/cm3 |
| Melting point | 107℃ |
| Boiling point | 408.9°C at 760 mmHg |
| Flash point | 201.1°C |
| Refractive index | 1.651 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
77006-26-9 6-(4-bromophenoxy)pyridin-3-amine
service@apichina.com