| Product Name | 6-[(2,5-dichlorophenyl)thio]pyridin-3-amine |
| CAS No. | 219865-85-7 |
| Synonyms | 6-[(2,5-dichlorophenyl)sulfanyl]pyridin-3-amine |
| InChI | InChI=1/C11H8Cl2N2S/c12-7-1-3-9(13)10(5-7)16-11-4-2-8(14)6-15-11/h1-6H,14H2 |
| Molecular Formula | C11H8Cl2N2S |
| Molecular Weight | 271.1656 |
| Density | 1.48g/cm3 |
| Melting point | 108℃ |
| Boiling point | 448.2°C at 760 mmHg |
| Flash point | 224.9°C |
| Refractive index | 1.698 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
219865-85-7 6-[(2,5-dichlorophenyl)thio]pyridin-3-amine
service@apichina.com