| Product Name | 6-{2-[4-(dimethylamino)phenyl]ethenyl}-4-methoxy-2H-pyran-2-one |
| CAS No. | 60427-78-3 |
| InChI | InChI=1/C16H17NO3/c1-17(2)13-7-4-12(5-8-13)6-9-14-10-15(19-3)11-16(18)20-14/h4-11H,1-3H3 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.3111 |
| Density | 1.17g/cm3 |
| Boiling point | 499.7°C at 760 mmHg |
| Flash point | 256°C |
| Refractive index | 1.589 |
60427-78-3 6-{2-[4-(dimethylamino)phenyl]ethenyl}-4-methoxy-2h-pyran-2-one
service@apichina.com