| Product Name | 6-(2,4-dichlorophenoxy)pyridin-3-amine |
| CAS No. | 85686-48-2 |
| InChI | InChI=1/C11H8Cl2N2O/c12-7-1-3-10(9(13)5-7)16-11-4-2-8(14)6-15-11/h1-6H,14H2 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.1 |
| Density | 1.421g/cm3 |
| Melting point | 111℃ |
| Boiling point | 400.6°C at 760 mmHg |
| Flash point | 196.1°C |
| Refractive index | 1.642 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
85686-48-2 6-(2,4-dichlorophenoxy)pyridin-3-amine
service@apichina.com