| Product Name | 5-undecyl-1H-1,2,4-triazol-3-amine |
| CAS No. | 92168-88-2 |
| InChI | InChI=1/C13H26N4/c1-2-3-4-5-6-7-8-9-10-11-12-15-13(14)17-16-12/h2-11H2,1H3,(H3,14,15,16,17) |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.3723 |
| Density | 1.002g/cm3 |
| Boiling point | 411.4°C at 760 mmHg |
| Flash point | 231.8°C |
| Refractive index | 1.52 |
92168-88-2 5-undecyl-1h-1,2,4-triazol-3-amine
service@apichina.com