| Product Name | 5-(thien-2-yl)thiophene-2-carbonitrile |
| CAS No. | 16278-99-2 |
| Synonyms | 2,2'-bithiophene-5-carbonitrile |
| InChI | InChI=1/C9H5NS2/c10-6-7-3-4-9(12-7)8-2-1-5-11-8/h1-5H |
| Molecular Formula | C9H5NS2 |
| Molecular Weight | 191.2727 |
| Density | 1.36g/cm3 |
| Melting point | 73℃ |
| Boiling point | 321.9°C at 760 mmHg |
| Flash point | 148.5°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
16278-99-2 5-(thien-2-yl)thiophene-2-carbonitrile
service@apichina.com