| Product Name | 5-Phenyl-o-anisidine |
| CAS No. | 39811-17-1 |
| InChI | InChI=1/C13H19NO/c1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10/h7-10H,2-6,14H2,1H3 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.2961 |
| Density | 1.042g/cm3 |
| Melting point | 81-84℃ |
| Boiling point | 337.8°C at 760 mmHg |
| Flash point | 159°C |
| Refractive index | 1.553 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
39811-17-1 5-phenyl-o-anisidine
service@apichina.com