| Product Name | 5-phenyl-2-thienyl isocyanate |
| CAS No. | 321309-34-6 |
| Synonyms | 2-isocyanato-5-phenylthiophene |
| InChI | InChI=1/C11H7NOS/c13-8-12-11-7-6-10(14-11)9-4-2-1-3-5-9/h1-7H |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.2444 |
| Density | 1.18g/cm3 |
| Boiling point | 327.7°C at 760 mmHg |
| Flash point | 152°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
321309-34-6 5-phenyl-2-thienyl isocyanate
service@apichina.com