| Product Name | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
| CAS No. | 98591-60-7 |
| InChI | InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.6012 |
| Density | 1.387g/cm3 |
| Melting point | 80℃ |
| Boiling point | 352.1°C at 760 mmHg |
| Flash point | 166.8°C |
| Refractive index | 1.573 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
98591-60-7 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride
service@apichina.com