| Product Name | 5-Norbornen-2-yl acetate |
| CAS No. | 6143-29-9 |
| Synonyms | 5-Norbornen-2-yl Acetate, mixture of endoand exo; Bicyclo[2.2.1]-5-hepten-2-yl Acetate; 2-acetoxy-5-norbornene; 5-Norbornen-2-yl acetate, mixture of endo and exo; Acetic acid, 5-norbornen-2-yl ester; Acetic acid, bicyclo[2.2.1]hept-5-en-2-yl ester; Bicyclo[2.2.1]hept-5-en-2-ol, acetate; 5-NORBORNENE-2-YL ACETATE; bicyclo[2.2.1]hept-5-en-2-yl acetate; (1S,2R,4S)-bicyclo[2.2.1]hept-5-en-2-yl acetate; (1S,2S,4S)-bicyclo[2.2.1]hept-5-en-2-yl acetate; (2E)-3-[5-(2-nitrophenyl)furan-2-yl]-1-tricyclo[3.3.1.1~3,7~]dec-1-ylprop-2-en-1-one |
| InChI | InChI=1/C23H23NO4/c25-22(23-12-15-9-16(13-23)11-17(10-15)14-23)8-6-18-5-7-21(28-18)19-3-1-2-4-20(19)24(26)27/h1-8,15-17H,9-14H2/b8-6+ |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.433 |
| Density | 1.282g/cm3 |
| Boiling point | 545.7°C at 760 mmHg |
| Flash point | 283.8°C |
| Refractive index | 1.636 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6143-29-9 5-norbornen-2-yl acetate
service@apichina.com