| Product Name | 5-Nitrothiophene-2-carbonitrile |
| CAS No. | 16689-02-4 |
| Synonyms | 2-Cyano-5-nitrothiophene |
| InChI | InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Molecular Formula | C5H2N2O2S |
| Molecular Weight | 154.1466 |
| Density | 1.5g/cm3 |
| Boiling point | 273.9°C at 760 mmHg |
| Flash point | 119.4°C |
| Refractive index | 1.611 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
16689-02-4 5-nitrothiophene-2-carbonitrile
service@apichina.com