| Product Name | 5-Nitroacenaphthene |
| CAS No. | 602-87-9 |
| Synonyms | 1,2-Dihydro-5-nitro-acenaphthylene; 4-05-00-01840 (Beilstein Handbook Reference); 5-Nan; 5-Nitroacenaphthylene; 5-Nitroacenapthene; 5-Nitronaphthalene; 5-Nitronaphthalene ethylene; Acenaphthene, 5-nitro-; Acenaphthylene, 1,2-dihydro-5-nitro-; BRN 1876864; CCRIS 438; HSDB 4092; NCI-C01967; NSC 1312; NSC 22421; 1,2-Dihydro-5-nitroacenaphthylene; 5-nitro-1,2-dihydroacenaphthylene; Nitroacenaphthene; 1,2-dihydro-5-nitro-acenaphthylen |
| InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.1895 |
| Density | 1.408g/cm3 |
| Melting point | 101-102℃ |
| Boiling point | 381.6°C at 760 mmHg |
| Flash point | 196.7°C |
| Refractive index | 1.763 |
| Risk Codes | R45:May cause cancer.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
602-87-9 5-nitroacenaphthene
service@apichina.com