| Product Name | 5-nitro-3-phenyl-1H-indole-2-carboxylic acid |
| CAS No. | 14182-37-7 |
| InChI | InChI=1/C15H10N2O4/c18-15(19)14-13(9-4-2-1-3-5-9)11-8-10(17(20)21)6-7-12(11)16-14/h1-8,16H,(H,18,19) |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.2509 |
| Density | 1.473g/cm3 |
| Melting point | 290℃ |
| Boiling point | 553.4°C at 760 mmHg |
| Flash point | 288.5°C |
| Refractive index | 1.731 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
14182-37-7 5-nitro-3-phenyl-1h-indole-2-carboxylic acid
service@apichina.com