| Product Name | 5-nitro-2-pyrrolidin-1-yl-benzaldehyde |
| CAS No. | 30742-59-7 |
| InChI | InChI=1/C11H12N2O3/c14-8-9-7-10(13(15)16)3-4-11(9)12-5-1-2-6-12/h3-4,7-8H,1-2,5-6H2 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.2246 |
| Density | 1.314g/cm3 |
| Melting point | 136℃ |
| Boiling point | 402.1°C at 760 mmHg |
| Flash point | 197°C |
| Refractive index | 1.632 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
service@apichina.com