| Product Name | (5-nitro-2-furyl)methyl aminomethanimidothioate hydrobromide |
| CAS No. | 82118-18-1 |
| Synonyms | (5-nitrofuran-2-yl)methyl imidothiocarbamate hydrobromide |
| InChI | InChI=1/C6H7N3O3S.BrH/c7-6(8)13-3-4-1-2-5(12-4)9(10)11;/h1-2H,3H2,(H3,7,8);1H |
| Molecular Formula | C6H8BrN3O3S |
| Molecular Weight | 282.115 |
| Melting point | 183℃ |
| Boiling point | 366.2°C at 760 mmHg |
| Flash point | 175.3°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
82118-18-1 (5-nitro-2-furyl)methyl aminomethanimidothioate hydrobromide
service@apichina.com