| Product Name | 5-Nitro-2-furoylchloride |
| CAS No. | 25084-14-4 |
| Synonyms | 5-Nitro-2-furoyl chloride; 5-Nitrofuran-2-carbonyl chloride |
| InChI | InChI=1/C5H2ClNO4/c6-5(8)3-1-2-4(11-3)7(9)10/h1-2H |
| Molecular Formula | C5H2ClNO4 |
| Molecular Weight | 175.5267 |
| Density | 1.588g/cm3 |
| Boiling point | 272.7°C at 760 mmHg |
| Flash point | 118.7°C |
| Refractive index | 1.552 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
25084-14-4 5-nitro-2-furoylchloride
service@apichina.com