| Product Name | 5-Nitro-2-furonitrile |
| CAS No. | 59-82-5 |
| Synonyms | 5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Molecular Formula | C5H2N2O3 |
| Molecular Weight | 138.081 |
| Density | 1.46g/cm3 |
| Boiling point | 234.7°C at 760 mmHg |
| Flash point | 95.7°C |
| Refractive index | 1.544 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
59-82-5 5-nitro-2-furonitrile
service@apichina.com