| Product Name | 5-nitro-1-benzothiophene-2-carboxylic acid |
| CAS No. | 6345-55-7 |
| Synonyms | 5-nitro-1-benzothiophene-2-carboxylate |
| InChI | InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
| Molecular Formula | C9H4NO4S |
| Molecular Weight | 222.1979 |
| Melting point | 238℃ |
| Boiling point | 473.6°C at 760 mmHg |
| Flash point | 240.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
service@apichina.com