| Product Name | 5-nitro-1-benzothiophene-2-carbonyl chloride |
| CAS No. | 86010-32-4 |
| InChI | InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
| Molecular Formula | C9H4ClNO3S |
| Molecular Weight | 241.651 |
| Density | 1.597g/cm3 |
| Melting point | 158℃ |
| Boiling point | 401.7°C at 760 mmHg |
| Flash point | 196.7°C |
| Refractive index | 1.712 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
service@apichina.com