| Product Name | 5-Methylthio-1,3,4-thiadiazole-2-thiol |
| CAS No. | 6264-40-0 |
| Synonyms | 2-Mercapto-5-methylmercapto-1,3,4-thiadiazole; 5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
| InChI | InChI=1/C3H4N2S3/c1-7-3-5-4-2(6)8-3/h1H3,(H,4,6) |
| Molecular Formula | C3H4N2S3 |
| Molecular Weight | 164.2723 |
| Density | 1.67g/cm3 |
| Boiling point | 243.3°C at 760 mmHg |
| Flash point | 101°C |
| Refractive index | 1.818 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6264-40-0 5-methylthio-1,3,4-thiadiazole-2-thiol
service@apichina.com