| Sales Email | Service@apichina.com |
| CAS No. | 39499-34-8 |
| Product Name | 5-Methylisoxazole-3-carbonyl chloride |
| InChI | InChI=1/C5H4ClNO2/c1-3-2-4(5(6)8)7-9-3/h2H,1H3 |
| Molecular Formula | C5H4ClNO2 |
| Molecular Weight | 145.5438 |
| Density | 1.345g/cm3 |
| Boiling point | 243.7°C at 760 mmHg |
| Flash point | 101.2°C |
| Refractive index | 1.498 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
