| Product Name | 5-Methylfuran-2-boronic acid |
| CAS No. | 62306-79-0 |
| Synonyms | (5-Methyl-2-furanyl)-boronic acid; 5-Methylfuryl-2-boronic acid; (5-methyl-2-furyl)boronic acid |
| InChI | InChI=1/C5H7BO3/c1-4-2-3-5(9-4)6(7)8/h2-3,7-8H,1H3 |
| Molecular Formula | C5H7BO3 |
| Molecular Weight | 125.9183 |
| Density | 1.197g/cm3 |
| Boiling point | 264.365°C at 760 mmHg |
| Flash point | 113.684°C |
| Refractive index | 1.489 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
62306-79-0 5-methylfuran-2-boronic acid
service@apichina.com