| Product Name | 5-Methylcyclohexane-1,3-dione |
| CAS No. | 4341-24-6 |
| Synonyms | (5S)-3-hydroxy-5-methylcyclohex-2-en-1-one |
| InChI | InChI=1/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h4-5,8H,2-3H2,1H3/t5-/m0/s1 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.1531 |
| Density | 1.134g/cm3 |
| Melting point | 129-131℃ |
| Boiling point | 221.6°C at 760 mmHg |
| Flash point | 89.1°C |
| Refractive index | 1.517 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4341-24-6 5-methylcyclohexane-1,3-dione
service@apichina.com