| Product Name | 5-methyl-2-nitrobenzoic acid |
| CAS No. | 3113-72-2 |
| Synonyms | 6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
| InChI | InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.1455 |
| Density | 1.392g/cm3 |
| Melting point | 134-136℃ |
| Boiling point | 367.6°C at 760 mmHg |
| Flash point | 166.8°C |
| Refractive index | 1.6 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3113-72-2 5-methyl-2-nitrobenzoic acid
service@apichina.com