| Product Name | 5-Methyl-2-furanmethanol |
| CAS No. | 3857-25-8 |
| Synonyms | (5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| InChI | InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.1265 |
| Density | 1.095g/cm3 |
| Boiling point | 178.5°C at 760 mmHg |
| Flash point | 61.8°C |
| Refractive index | 1.494 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
3857-25-8 5-methyl-2-furanmethanol
service@apichina.com