| Product Name | 5-Methyl-1-phenylpyrazole-4-carboxylic acid |
| CAS No. | 91138-00-0 |
| Synonyms | 5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
| InChI | InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.2093 |
| Density | 1.24g/cm3 |
| Melting point | 163℃ |
| Boiling point | 382.9°C at 760 mmHg |
| Flash point | 185.4°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
91138-00-0 5-methyl-1-phenylpyrazole-4-carboxylic acid
service@apichina.com