| Product Name | 5-methyl-1-phenyl-1H-pyrazole-4-carbonyl chloride |
| CAS No. | 205113-77-5 |
| InChI | InChI=1/C11H9ClN2O/c1-8-10(11(12)15)7-13-14(8)9-5-3-2-4-6-9/h2-7H,1H3 |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.655 |
| Density | 1.26g/cm3 |
| Melting point | 148℃ |
| Boiling point | 333.4°C at 760 mmHg |
| Flash point | 155.4°C |
| Refractive index | 1.611 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S6:Keep under inert gas.; |
205113-77-5 5-methyl-1-phenyl-1h-pyrazole-4-carbonyl chloride
service@apichina.com