| Product Name | (5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol |
| CAS No. | 153863-35-5 |
| InChI | InChI=1/C11H12N2O/c1-9-10(8-14)7-12-13(9)11-5-3-2-4-6-11/h2-7,14H,8H2,1H3 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.2258 |
| Density | 1.14g/cm3 |
| Melting point | 88℃ |
| Boiling point | 346°C at 760 mmHg |
| Flash point | 163.1°C |
| Refractive index | 1.593 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
153863-35-5 (5-methyl-1-phenyl-1h-pyrazol-4-yl)methanol
service@apichina.com