| Product Name | 5-Methoxy-1-methylindole-3-carboxaldehyde |
| CAS No. | 39974-94-2 |
| Synonyms | 3-Formyl-5-methoxy-1-methylindole; 5-methoxy-1-methyl-1H-indole-3-carbaldehyde |
| InChI | InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.2105 |
| Density | 1.14g/cm3 |
| Boiling point | 357.9°C at 760 mmHg |
| Flash point | 170.2°C |
| Refractive index | 1.565 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
39974-94-2 5-methoxy-1-methylindole-3-carboxaldehyde
service@apichina.com