| Product Name | 5-Methoxy-1-methyl-4-nitroindole-3-carboxaldehyde |
| CAS No. | 191846-76-1 |
| Synonyms | 3-Formyl-5-methoxy-1-methyl-4-nitroindole; 5-methoxy-1-methyl-4-nitro-1H-indole-3-carbaldehyde |
| InChI | InChI=1/C11H10N2O4/c1-12-5-7(6-14)10-8(12)3-4-9(17-2)11(10)13(15)16/h3-6H,1-2H3 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.2081 |
| Density | 1.371g/cm3 |
| Boiling point | 455.737°C at 760 mmHg |
| Flash point | 229.422°C |
| Refractive index | 1.615 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
191846-76-1 5-methoxy-1-methyl-4-nitroindole-3-carboxaldehyde
service@apichina.com