| Product Name | (5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid |
| CAS No. | 53723-88-9 |
| Synonyms | 2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetate; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid; [(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid |
| InChI | InChI=1/C4H4N2O2S3/c7-2(8)1-10-4-6-5-3(9)11-4/h1H2,(H,5,9)(H,7,8) |
| Molecular Formula | C4H4N2O2S3 |
| Molecular Weight | 208.2818 |
| Density | 1.89g/cm3 |
| Melting point | 158-160℃ |
| Boiling point | 380.6°C at 760 mmHg |
| Flash point | 184°C |
| Refractive index | 1.85 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S36:Wear suitable protective clothing.; S37/39:Wear suitable gloves and eye/face protection.; |
53723-88-9 (5-mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
service@apichina.com