| Product Name | 5-Isopropyl-2-methoxybenzeneboronic acid |
| CAS No. | 216393-63-4 |
| Synonyms | (5-Isopropyl-2-methoxyphenyl)boronic acid; boronic acid, B-[2-methoxy-5-(1-methylethyl)phenyl]-; [2-methoxy-5-(1-methylethyl)phenyl]boronic acid; 5-Isopropyl-2-methoxyphenylboronic acid |
| InChI | InChI=1/C10H15BO3/c1-7(2)8-4-5-10(14-3)9(6-8)11(12)13/h4-7,12-13H,1-3H3 |
| Molecular Formula | C10H15BO3 |
| Molecular Weight | 194.0353 |
| Density | 1.08g/cm3 |
| Boiling point | 350°C at 760 mmHg |
| Flash point | 165.5°C |
| Refractive index | 1.509 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216393-63-4 5-isopropyl-2-methoxybenzeneboronic acid
service@apichina.com