| Product Name | 5-Isopropyl-2-methoxybenzaldehyde |
| CAS No. | 85902-68-7 |
| Synonyms | 2-methoxy-5-(1-methylethyl)benzaldehyde |
| InChI | InChI=1/C11H14O2/c1-8(2)9-4-5-11(13-3)10(6-9)7-12/h4-8H,1-3H3 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.2277 |
| Density | 1.017g/cm3 |
| Boiling point | 274.7°C at 760 mmHg |
| Flash point | 114.5°C |
| Refractive index | 1.527 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
85902-68-7 5-isopropyl-2-methoxybenzaldehyde
service@apichina.com