| Product Name | 5-Iodovanillin |
| CAS No. | 5438-36-8 |
| Synonyms | 4-Hydroxy-3-iodo-5-methoxybenzaldehyde |
| InChI | InChI=1/C8H7IO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3 |
| Molecular Formula | C8H7IO3 |
| Molecular Weight | 278.0439 |
| Density | 1.909g/cm3 |
| Melting point | 180-184℃ |
| Boiling point | 304.1°C at 760 mmHg |
| Flash point | 137.7°C |
| Refractive index | 1.671 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5438-36-8 5-iodovanillin
service@apichina.com